C22H25N4OS+ — CID 9336405
(E)-1-(4-ethylpiperazin-4-ium-1-yl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 9336405) has the molecular formula C22H25N4OS+ and a molecular weight of 393.54 g/mol. Its IUPAC name is (E)-1-(4-ethylpiperazin-4-ium-1-yl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-ethylpiperazin-4-ium-1-yl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9336405 |
| Molecular Formula | C22H25N4OS+ |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (E)-1-(4-ethylpiperazin-4-ium-1-yl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | CC[NH+]1CCN(C(=O)/C=C/c2cn(-c3ccccc3)nc2-c2cccs2)CC1 |
| InChI | InChI=1S/C22H24N4OS/c1-2-24-12-14-25(15-13-24)21(27)11-10-18-17-26(19-7-4-3-5-8-19)23-22(18)20-9-6-16-28-20/h3-11,16-17H,2,12-15H2,1H3/p+1/b11-10+ |
| InChIKey | LQPKSTOPKQEDNK-ZHACJKMWSA-O |
| XLogP | 2.36 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|