C24H21N3OS — CID 4022012
N-(2-phenylethyl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 4022012) has the molecular formula C24H21N3OS and a molecular weight of 399.52 g/mol. Its IUPAC name is N-(2-phenylethyl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | N-(2-phenylethyl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4022012 |
| Molecular Formula | C24H21N3OS |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-(2-phenylethyl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1cn(-c2ccccc2)nc1-c1cccs1)NCCc1ccccc1 |
| InChI | InChI=1S/C24H21N3OS/c28-23(25-16-15-19-8-3-1-4-9-19)14-13-20-18-27(21-10-5-2-6-11-21)26-24(20)22-12-7-17-29-22/h1-14,17-18H,15-16H2,(H,25,28) |
| InChIKey | ONPITHOBXGLCLV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|