C24H21N5O2S — CID 55510750
(E)-N-[[4-(carbamoylamino)phenyl]methyl]-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 55510750) has the molecular formula C24H21N5O2S and a molecular weight of 443.53 g/mol. Its IUPAC name is (E)-N-[[4-(carbamoylamino)phenyl]methyl]-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[[4-(carbamoylamino)phenyl]methyl]-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55510750 |
| Molecular Formula | C24H21N5O2S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (E)-N-[[4-(carbamoylamino)phenyl]methyl]-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | NC(=O)Nc1ccc(CNC(=O)/C=C/c2cn(-c3ccccc3)nc2-c2cccs2)cc1 |
| InChI | InChI=1S/C24H21N5O2S/c25-24(31)27-19-11-8-17(9-12-19)15-26-22(30)13-10-18-16-29(20-5-2-1-3-6-20)28-23(18)21-7-4-14-32-21/h1-14,16H,15H2,(H,26,30)(H3,25,27,31)/b13-10+ |
| InChIKey | JGBVTDSLSPADRB-JLHYYAGUSA-N |
| XLogP | 4.42 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|