C22H25ClN4O2S — CID 73242598
N-(2-morpholin-4-ylethyl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide;hydrochloride (PubChem CID 73242598) has the molecular formula C22H25ClN4O2S and a molecular weight of 444.99 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide;hydrochloride.
| Compound Name | N-(2-morpholin-4-ylethyl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 73242598 |
| Molecular Formula | C22H25ClN4O2S |
| Molecular Weight | 444.99 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide;hydrochloride |
| SMILES | Cl.O=C(C=Cc1cn(-c2ccccc2)nc1-c1cccs1)NCCN1CCOCC1 |
| InChI | InChI=1S/C22H24N4O2S.ClH/c27-21(23-10-11-25-12-14-28-15-13-25)9-8-18-17-26(19-5-2-1-3-6-19)24-22(18)20-7-4-16-29-20;/h1-9,16-17H,10-15H2,(H,23,27);1H |
| InChIKey | LUWMUQUHOKZFLN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.99 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|