C29H27Cl2N5O3S — CID 4292798
2,4-dichloro-N-[3-(2-morpholin-4-ylethylamino)-3-oxo-1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-1-en-2-yl]benzamide (PubChem CID 4292798) has the molecular formula C29H27Cl2N5O3S and a molecular weight of 596.54 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-(2-morpholin-4-ylethylamino)-3-oxo-1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-1-en-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-(2-morpholin-4-ylethylamino)-3-oxo-1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 4292798 |
| Molecular Formula | C29H27Cl2N5O3S |
| Molecular Weight | 596.54 g/mol |
| Exact Mass | 595.12 |
| IUPAC Name | 2,4-dichloro-N-[3-(2-morpholin-4-ylethylamino)-3-oxo-1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-1-en-2-yl]benzamide |
| SMILES | O=C(NCCN1CCOCC1)C(=Cc1cn(-c2ccccc2)nc1-c1cccs1)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H27Cl2N5O3S/c30-21-8-9-23(24(31)18-21)28(37)33-25(29(38)32-10-11-35-12-14-39-15-13-35)17-20-19-36(22-5-2-1-3-6-22)34-27(20)26-7-4-16-40-26/h1-9,16-19H,10-15H2,(H,32,38)(H,33,37) |
| InChIKey | OIEYNJNWMAJNRY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|