C27H21Cl3N4O3 — CID 4096397
2,4-dichloro-N-[1-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 4096397) has the molecular formula C27H21Cl3N4O3 and a molecular weight of 555.85 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 4096397 |
| Molecular Formula | C27H21Cl3N4O3 |
| Molecular Weight | 555.85 g/mol |
| Exact Mass | 554.07 |
| IUPAC Name | 2,4-dichloro-N-[1-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(NCCO)C(=Cc1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H21Cl3N4O3/c28-19-8-6-17(7-9-19)25-18(16-34(33-25)21-4-2-1-3-5-21)14-24(27(37)31-12-13-35)32-26(36)22-11-10-20(29)15-23(22)30/h1-11,14-16,35H,12-13H2,(H,31,37)(H,32,36) |
| InChIKey | UWBWCRDEXCWWLK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.85 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|