C25H19Cl2FN6O2 — CID 4207317
2,4-dichloro-N-[2-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-1-(hydrazinecarbonylamino)ethenyl]benzamide (PubChem CID 4207317) has the molecular formula C25H19Cl2FN6O2 and a molecular weight of 525.37 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-1-(hydrazinecarbonylamino)ethenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-1-(hydrazinecarbonylamino)ethenyl]benzamide |
|---|---|
| PubChem CID | 4207317 |
| Molecular Formula | C25H19Cl2FN6O2 |
| Molecular Weight | 525.37 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | 2,4-dichloro-N-[2-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-1-(hydrazinecarbonylamino)ethenyl]benzamide |
| SMILES | NNC(=O)NC(=Cc1cn(-c2ccccc2)nc1-c1ccc(F)cc1)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H19Cl2FN6O2/c26-17-8-11-20(21(27)13-17)24(35)30-22(31-25(36)32-29)12-16-14-34(19-4-2-1-3-5-19)33-23(16)15-6-9-18(28)10-7-15/h1-14H,29H2,(H,30,35)(H2,31,32,36) |
| InChIKey | WCZAIRINAZVAOL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|