C31H22Cl3N5O2 — CID 3587562
3,5-dichloro-N-[1-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-3-oxo-3-(pyridin-2-ylmethylamino)prop-1-en-2-yl]benzamide (PubChem CID 3587562) has the molecular formula C31H22Cl3N5O2 and a molecular weight of 602.91 g/mol. Its IUPAC name is 3,5-dichloro-N-[1-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-3-oxo-3-(pyridin-2-ylmethylamino)prop-1-en-2-yl]benzamide.
| Compound Name | 3,5-dichloro-N-[1-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-3-oxo-3-(pyridin-2-ylmethylamino)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3587562 |
| Molecular Formula | C31H22Cl3N5O2 |
| Molecular Weight | 602.91 g/mol |
| Exact Mass | 601.08 |
| IUPAC Name | 3,5-dichloro-N-[1-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-3-oxo-3-(pyridin-2-ylmethylamino)prop-1-en-2-yl]benzamide |
| SMILES | O=C(NCc1ccccn1)C(=Cc1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1)NC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C31H22Cl3N5O2/c32-23-11-9-20(10-12-23)29-22(19-39(38-29)27-7-2-1-3-8-27)16-28(31(41)36-18-26-6-4-5-13-35-26)37-30(40)21-14-24(33)17-25(34)15-21/h1-17,19H,18H2,(H,36,41)(H,37,40) |
| InChIKey | GNNWPEPULCYGNG-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.91 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|