C33H27N3O2 — CID 161312200
N-[(E)-1-(1,3-diphenylpyrazol-4-yl)-3-oxo-5-phenylpent-1-en-2-yl]benzamide (PubChem CID 161312200) has the molecular formula C33H27N3O2 and a molecular weight of 497.60 g/mol. Its IUPAC name is N-[(E)-1-(1,3-diphenylpyrazol-4-yl)-3-oxo-5-phenylpent-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(1,3-diphenylpyrazol-4-yl)-3-oxo-5-phenylpent-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 161312200 |
| Molecular Formula | C33H27N3O2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-[(E)-1-(1,3-diphenylpyrazol-4-yl)-3-oxo-5-phenylpent-1-en-2-yl]benzamide |
| SMILES | O=C(CCc1ccccc1)/C(=C\c1cn(-c2ccccc2)nc1-c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H27N3O2/c37-31(22-21-25-13-5-1-6-14-25)30(34-33(38)27-17-9-3-10-18-27)23-28-24-36(29-19-11-4-12-20-29)35-32(28)26-15-7-2-8-16-26/h1-20,23-24H,21-22H2,(H,34,38)/b30-23+ |
| InChIKey | VJARNQHYJCXDDP-JJKYIXSRSA-N |
| XLogP | 6.51 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|