C25H14Cl4N4OS — CID 98334737
3,4,6-trichloro-N-[(Z)-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 98334737) has the molecular formula C25H14Cl4N4OS and a molecular weight of 560.29 g/mol. Its IUPAC name is 3,4,6-trichloro-N-[(Z)-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,4,6-trichloro-N-[(Z)-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 98334737 |
| Molecular Formula | C25H14Cl4N4OS |
| Molecular Weight | 560.29 g/mol |
| Exact Mass | 557.96 |
| IUPAC Name | 3,4,6-trichloro-N-[(Z)-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(N/N=C\c1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1)c1sc2cc(Cl)cc(Cl)c2c1Cl |
| InChI | InChI=1S/C25H14Cl4N4OS/c26-16-8-6-14(7-9-16)23-15(13-33(32-23)18-4-2-1-3-5-18)12-30-31-25(34)24-22(29)21-19(28)10-17(27)11-20(21)35-24/h1-13H,(H,31,34)/b30-12- |
| InChIKey | JFQXGOKVLZQNOG-FTCYSYDXSA-N |
| XLogP | 8.13 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.29 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|