C22H15Cl2N5O — CID 2127687
2,5-dichloro-N-[(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylideneamino]benzamide (PubChem CID 2127687) has the molecular formula C22H15Cl2N5O and a molecular weight of 436.30 g/mol. Its IUPAC name is 2,5-dichloro-N-[(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylideneamino]benzamide.
| Compound Name | 2,5-dichloro-N-[(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 2127687 |
| Molecular Formula | C22H15Cl2N5O |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 2,5-dichloro-N-[(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1cn(-c2ccccc2)nc1-c1cccnc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C22H15Cl2N5O/c23-17-8-9-20(24)19(11-17)22(30)27-26-13-16-14-29(18-6-2-1-3-7-18)28-21(16)15-5-4-10-25-12-15/h1-14H,(H,27,30) |
| InChIKey | FHLUKVYVYKKZBM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|