C23H16Cl2N4O2 — CID 2330365
N-[[3-(2,4-dichlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-hydroxybenzamide (PubChem CID 2330365) has the molecular formula C23H16Cl2N4O2 and a molecular weight of 451.31 g/mol. Its IUPAC name is N-[[3-(2,4-dichlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-hydroxybenzamide.
| Compound Name | N-[[3-(2,4-dichlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 2330365 |
| Molecular Formula | C23H16Cl2N4O2 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | N-[[3-(2,4-dichlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-hydroxybenzamide |
| SMILES | O=C(NN=Cc1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1Cl)c1cccc(O)c1 |
| InChI | InChI=1S/C23H16Cl2N4O2/c24-17-9-10-20(21(25)12-17)22-16(14-29(28-22)18-6-2-1-3-7-18)13-26-27-23(31)15-5-4-8-19(30)11-15/h1-14,30H,(H,27,31) |
| InChIKey | XWJZWERIRJLGPS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|