C31H23N7O3 — CID 162654759
N-[(E)-[3-(2,4-dihydroxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-(4-phenyltriazol-1-yl)benzamide (PubChem CID 162654759) has the molecular formula C31H23N7O3 and a molecular weight of 541.57 g/mol. Its IUPAC name is N-[(E)-[3-(2,4-dihydroxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-(4-phenyltriazol-1-yl)benzamide.
| Compound Name | N-[(E)-[3-(2,4-dihydroxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-(4-phenyltriazol-1-yl)benzamide |
|---|---|
| PubChem CID | 162654759 |
| Molecular Formula | C31H23N7O3 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | N-[(E)-[3-(2,4-dihydroxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-(4-phenyltriazol-1-yl)benzamide |
| SMILES | O=C(N/N=C/c1cn(-c2ccccc2)nc1-c1ccc(O)cc1O)c1cccc(-n2cc(-c3ccccc3)nn2)c1 |
| InChI | InChI=1S/C31H23N7O3/c39-26-14-15-27(29(40)17-26)30-23(19-37(35-30)24-11-5-2-6-12-24)18-32-34-31(41)22-10-7-13-25(16-22)38-20-28(33-36-38)21-8-3-1-4-9-21/h1-20,39-40H,(H,34,41)/b32-18+ |
| InChIKey | CNVQHNJOBCYPOV-KCSSXMTESA-N |
| XLogP | 4.96 |
| TPSA | 130.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|