C31H24Cl2N4O3 — CID 51061895
4-[(2,4-dichlorophenyl)methoxy]-N-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide (PubChem CID 51061895) has the molecular formula C31H24Cl2N4O3 and a molecular weight of 571.46 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methoxy]-N-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide.
| Compound Name | 4-[(2,4-dichlorophenyl)methoxy]-N-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 51061895 |
| Molecular Formula | C31H24Cl2N4O3 |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methoxy]-N-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=N/NC(=O)c2ccc(OCc3ccc(Cl)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C31H24Cl2N4O3/c1-39-27-13-8-21(9-14-27)30-24(19-37(36-30)26-5-3-2-4-6-26)18-34-35-31(38)22-10-15-28(16-11-22)40-20-23-7-12-25(32)17-29(23)33/h2-19H,20H2,1H3,(H,35,38)/b34-18+ |
| InChIKey | LLFWISCEANVPMW-FABQOPTDSA-N |
| XLogP | 7.20 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|