C28H23ClN6O2 — CID 1027705
1-[(4-chlorophenyl)methyl]-N-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]pyrazole-3-carboxamide (PubChem CID 1027705) has the molecular formula C28H23ClN6O2 and a molecular weight of 510.99 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]pyrazole-3-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 1027705 |
| Molecular Formula | C28H23ClN6O2 |
| Molecular Weight | 510.99 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]pyrazole-3-carboxamide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C=NNC(=O)c2ccn(Cc3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C28H23ClN6O2/c1-37-25-13-9-21(10-14-25)27-22(19-35(33-27)24-5-3-2-4-6-24)17-30-31-28(36)26-15-16-34(32-26)18-20-7-11-23(29)12-8-20/h2-17,19H,18H2,1H3,(H,31,36) |
| InChIKey | XVTJXGDGTFAYIL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.99 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|