C31H25ClN4O2 — CID 51061156
4-[(4-chlorophenyl)methoxy]-N-[(E)-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide (PubChem CID 51061156) has the molecular formula C31H25ClN4O2 and a molecular weight of 521.02 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methoxy]-N-[(E)-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide.
| Compound Name | 4-[(4-chlorophenyl)methoxy]-N-[(E)-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 51061156 |
| Molecular Formula | C31H25ClN4O2 |
| Molecular Weight | 521.02 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 4-[(4-chlorophenyl)methoxy]-N-[(E)-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide |
| SMILES | Cc1cccc(-c2nn(-c3ccccc3)cc2/C=N/NC(=O)c2ccc(OCc3ccc(Cl)cc3)cc2)c1 |
| InChI | InChI=1S/C31H25ClN4O2/c1-22-6-5-7-25(18-22)30-26(20-36(35-30)28-8-3-2-4-9-28)19-33-34-31(37)24-12-16-29(17-13-24)38-21-23-10-14-27(32)15-11-23/h2-20H,21H2,1H3,(H,34,37)/b33-19+ |
| InChIKey | DVOULJIXWQQFPS-HNSNBQBZSA-N |
| XLogP | 6.84 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.02 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|