C30H23N5O4 — CID 4078955
4-nitro-N-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide (PubChem CID 4078955) has the molecular formula C30H23N5O4 and a molecular weight of 517.55 g/mol. Its IUPAC name is 4-nitro-N-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide.
| Compound Name | 4-nitro-N-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 4078955 |
| Molecular Formula | C30H23N5O4 |
| Molecular Weight | 517.55 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | 4-nitro-N-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1cn(-c2ccccc2)nc1-c1ccc(OCc2ccccc2)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H23N5O4/c36-30(24-11-15-27(16-12-24)35(37)38)32-31-19-25-20-34(26-9-5-2-6-10-26)33-29(25)23-13-17-28(18-14-23)39-21-22-7-3-1-4-8-22/h1-20H,21H2,(H,32,36) |
| InChIKey | PHBMQTLGVAXSMZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|