C26H19ClN4OS — CID 6272285
3-chloro-N-[(Z)-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 6272285) has the molecular formula C26H19ClN4OS and a molecular weight of 470.99 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(Z)-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 6272285 |
| Molecular Formula | C26H19ClN4OS |
| Molecular Weight | 470.99 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 3-chloro-N-[(Z)-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1cccc(-c2nn(-c3ccccc3)cc2/C=N\NC(=O)c2sc3ccccc3c2Cl)c1 |
| InChI | InChI=1S/C26H19ClN4OS/c1-17-8-7-9-18(14-17)24-19(16-31(30-24)20-10-3-2-4-11-20)15-28-29-26(32)25-23(27)21-12-5-6-13-22(21)33-25/h2-16H,1H3,(H,29,32)/b28-15- |
| InChIKey | VLRFLBGZZWQHIM-MBTHVWNTSA-N |
| XLogP | 6.48 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.99 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|