C24H26N4O — CID 51061602
N-[(E)-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]cyclohexanecarboxamide (PubChem CID 51061602) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is N-[(E)-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]cyclohexanecarboxamide.
| Compound Name | N-[(E)-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 51061602 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-[(E)-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]cyclohexanecarboxamide |
| SMILES | Cc1cccc(-c2nn(-c3ccccc3)cc2/C=N/NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C24H26N4O/c1-18-9-8-12-20(15-18)23-21(17-28(27-23)22-13-6-3-7-14-22)16-25-26-24(29)19-10-4-2-5-11-19/h3,6-9,12-17,19H,2,4-5,10-11H2,1H3,(H,26,29)/b25-16+ |
| InChIKey | QPFQWOCVPVIGBS-PCLIKHOPSA-N |
| XLogP | 4.88 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|