C29H28N4O3S — CID 42558342
N-[(Z)-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-oxo-1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-1-en-2-yl]benzamide (PubChem CID 42558342) has the molecular formula C29H28N4O3S and a molecular weight of 512.64 g/mol. Its IUPAC name is N-[(Z)-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-oxo-1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-oxo-1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 42558342 |
| Molecular Formula | C29H28N4O3S |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | N-[(Z)-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-oxo-1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-1-en-2-yl]benzamide |
| SMILES | C[C@@H]1CN(C(=O)/C(=C/c2cn(-c3ccccc3)nc2-c2cccs2)NC(=O)c2ccccc2)C[C@H](C)O1 |
| InChI | InChI=1S/C29H28N4O3S/c1-20-17-32(18-21(2)36-20)29(35)25(30-28(34)22-10-5-3-6-11-22)16-23-19-33(24-12-7-4-8-13-24)31-27(23)26-14-9-15-37-26/h3-16,19-21H,17-18H2,1-2H3,(H,30,34)/b25-16-/t20-,21+ |
| InChIKey | DLWRVAGSGZXBPK-ZRRUGVMFSA-N |
| XLogP | 5.01 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|