C25H20N4OS — CID 6259308
(E)-2-cyano-N-(1-phenylethyl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 6259308) has the molecular formula C25H20N4OS and a molecular weight of 424.53 g/mol. Its IUPAC name is (E)-2-cyano-N-(1-phenylethyl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(1-phenylethyl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6259308 |
| Molecular Formula | C25H20N4OS |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | (E)-2-cyano-N-(1-phenylethyl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | CC(NC(=O)/C(C#N)=C/c1cn(-c2ccccc2)nc1-c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C25H20N4OS/c1-18(19-9-4-2-5-10-19)27-25(30)20(16-26)15-21-17-29(22-11-6-3-7-12-22)28-24(21)23-13-8-14-31-23/h2-15,17-18H,1H3,(H,27,30)/b20-15+ |
| InChIKey | NUORFVQBDRIKIB-HMMYKYKNSA-N |
| XLogP | 5.39 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|