C26H21N5O — CID 9030448
(E)-2-cyano-N-[(1S)-1-phenylethyl]-3-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 9030448) has the molecular formula C26H21N5O and a molecular weight of 419.49 g/mol. Its IUPAC name is (E)-2-cyano-N-[(1S)-1-phenylethyl]-3-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[(1S)-1-phenylethyl]-3-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9030448 |
| Molecular Formula | C26H21N5O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (E)-2-cyano-N-[(1S)-1-phenylethyl]-3-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | C[C@H](NC(=O)/C(C#N)=C/c1cn(-c2ccccc2)nc1-c1ccncc1)c1ccccc1 |
| InChI | InChI=1S/C26H21N5O/c1-19(20-8-4-2-5-9-20)29-26(32)22(17-27)16-23-18-31(24-10-6-3-7-11-24)30-25(23)21-12-14-28-15-13-21/h2-16,18-19H,1H3,(H,29,32)/b22-16+/t19-/m0/s1 |
| InChIKey | KCQBCUBYCBCPKX-QZMYASAMSA-N |
| XLogP | 4.72 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|