C25H18ClN5O — CID 18269374
(E)-N-(3-chloro-2-methylphenyl)-2-cyano-3-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 18269374) has the molecular formula C25H18ClN5O and a molecular weight of 439.91 g/mol. Its IUPAC name is (E)-N-(3-chloro-2-methylphenyl)-2-cyano-3-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-(3-chloro-2-methylphenyl)-2-cyano-3-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 18269374 |
| Molecular Formula | C25H18ClN5O |
| Molecular Weight | 439.91 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | (E)-N-(3-chloro-2-methylphenyl)-2-cyano-3-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)/C(C#N)=C/c1cn(-c2ccccc2)nc1-c1ccncc1 |
| InChI | InChI=1S/C25H18ClN5O/c1-17-22(26)8-5-9-23(17)29-25(32)19(15-27)14-20-16-31(21-6-3-2-4-7-21)30-24(20)18-10-12-28-13-11-18/h2-14,16H,1H3,(H,29,32)/b19-14+ |
| InChIKey | XOVLGFQDWPJJNR-XMHGGMMESA-N |
| XLogP | 5.44 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.91 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|