C24H16FN5O — CID 9030034
(E)-2-cyano-N-(4-fluorophenyl)-3-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 9030034) has the molecular formula C24H16FN5O and a molecular weight of 409.42 g/mol. Its IUPAC name is (E)-2-cyano-N-(4-fluorophenyl)-3-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(4-fluorophenyl)-3-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9030034 |
| Molecular Formula | C24H16FN5O |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (E)-2-cyano-N-(4-fluorophenyl)-3-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cn(-c2ccccc2)nc1-c1ccncc1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H16FN5O/c25-20-6-8-21(9-7-20)28-24(31)18(15-26)14-19-16-30(22-4-2-1-3-5-22)29-23(19)17-10-12-27-13-11-17/h1-14,16H,(H,28,31)/b18-14+ |
| InChIKey | QJDSZUYSALQTSA-NBVRZTHBSA-N |
| XLogP | 4.62 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|