C25H16ClN5O3 — CID 4710572
N-(2-chloro-4-nitrophenyl)-2-cyano-3-(1,3-diphenylpyrazol-4-yl)prop-2-enamide (PubChem CID 4710572) has the molecular formula C25H16ClN5O3 and a molecular weight of 469.89 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2-cyano-3-(1,3-diphenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2-cyano-3-(1,3-diphenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4710572 |
| Molecular Formula | C25H16ClN5O3 |
| Molecular Weight | 469.89 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2-cyano-3-(1,3-diphenylpyrazol-4-yl)prop-2-enamide |
| SMILES | N#CC(=Cc1cn(-c2ccccc2)nc1-c1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C25H16ClN5O3/c26-22-14-21(31(33)34)11-12-23(22)28-25(32)18(15-27)13-19-16-30(20-9-5-2-6-10-20)29-24(19)17-7-3-1-4-8-17/h1-14,16H,(H,28,32) |
| InChIKey | PKSMMUDNWSOGEI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.89 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|