C22H15N3O2S2 — CID 34307593
(E)-2-(benzenesulfonyl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enenitrile (PubChem CID 34307593) has the molecular formula C22H15N3O2S2 and a molecular weight of 417.52 g/mol. Its IUPAC name is (E)-2-(benzenesulfonyl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(benzenesulfonyl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 34307593 |
| Molecular Formula | C22H15N3O2S2 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | (E)-2-(benzenesulfonyl)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cn(-c2ccccc2)nc1-c1cccs1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H15N3O2S2/c23-15-20(29(26,27)19-10-5-2-6-11-19)14-17-16-25(18-8-3-1-4-9-18)24-22(17)21-12-7-13-28-21/h1-14,16H/b20-14+ |
| InChIKey | RQDYIHKAOXQJMJ-XSFVSMFZSA-N |
| XLogP | 4.94 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|