C21H22ClN5O2S — CID 46215292
2-chloro-N-(2-morpholin-4-ylethyl)-4-[(4-thiophen-2-ylpyrimidin-2-yl)amino]benzamide (PubChem CID 46215292) has the molecular formula C21H22ClN5O2S and a molecular weight of 443.96 g/mol. Its IUPAC name is 2-chloro-N-(2-morpholin-4-ylethyl)-4-[(4-thiophen-2-ylpyrimidin-2-yl)amino]benzamide.
| Compound Name | 2-chloro-N-(2-morpholin-4-ylethyl)-4-[(4-thiophen-2-ylpyrimidin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 46215292 |
| Molecular Formula | C21H22ClN5O2S |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 2-chloro-N-(2-morpholin-4-ylethyl)-4-[(4-thiophen-2-ylpyrimidin-2-yl)amino]benzamide |
| SMILES | O=C(NCCN1CCOCC1)c1ccc(Nc2nccc(-c3cccs3)n2)cc1Cl |
| InChI | InChI=1S/C21H22ClN5O2S/c22-17-14-15(25-21-24-6-5-18(26-21)19-2-1-13-30-19)3-4-16(17)20(28)23-7-8-27-9-11-29-12-10-27/h1-6,13-14H,7-12H2,(H,23,28)(H,24,25,26) |
| InChIKey | RPBZPGHNURIFMR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |