C21H24N4O2S — CID 17474823
1-benzyl-N-(2-morpholin-4-ylethyl)-3-thiophen-2-ylpyrazole-4-carboxamide (PubChem CID 17474823) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is 1-benzyl-N-(2-morpholin-4-ylethyl)-3-thiophen-2-ylpyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-(2-morpholin-4-ylethyl)-3-thiophen-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 17474823 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1-benzyl-N-(2-morpholin-4-ylethyl)-3-thiophen-2-ylpyrazole-4-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)c1cn(Cc2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C21H24N4O2S/c26-21(22-8-9-24-10-12-27-13-11-24)18-16-25(15-17-5-2-1-3-6-17)23-20(18)19-7-4-14-28-19/h1-7,14,16H,8-13,15H2,(H,22,26) |
| InChIKey | WUXPVBCEIGQWKB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |