C20H17N3OS2 — CID 9360117
1-benzyl-3-thiophen-2-yl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide (PubChem CID 9360117) has the molecular formula C20H17N3OS2 and a molecular weight of 379.51 g/mol. Its IUPAC name is 1-benzyl-3-thiophen-2-yl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-3-thiophen-2-yl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 9360117 |
| Molecular Formula | C20H17N3OS2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 1-benzyl-3-thiophen-2-yl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide |
| SMILES | O=C(NCc1cccs1)c1cn(Cc2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C20H17N3OS2/c24-20(21-12-16-8-4-10-25-16)17-14-23(13-15-6-2-1-3-7-15)22-19(17)18-9-5-11-26-18/h1-11,14H,12-13H2,(H,21,24) |
| InChIKey | SCSQQAQQRJQVOJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |