C22H20N4OS — CID 29352915
1-benzyl-N-(2-pyridin-2-ylethyl)-3-thiophen-2-ylpyrazole-4-carboxamide (PubChem CID 29352915) has the molecular formula C22H20N4OS and a molecular weight of 388.50 g/mol. Its IUPAC name is 1-benzyl-N-(2-pyridin-2-ylethyl)-3-thiophen-2-ylpyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-(2-pyridin-2-ylethyl)-3-thiophen-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 29352915 |
| Molecular Formula | C22H20N4OS |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 1-benzyl-N-(2-pyridin-2-ylethyl)-3-thiophen-2-ylpyrazole-4-carboxamide |
| SMILES | O=C(NCCc1ccccn1)c1cn(Cc2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C22H20N4OS/c27-22(24-13-11-18-9-4-5-12-23-18)19-16-26(15-17-7-2-1-3-8-17)25-21(19)20-10-6-14-28-20/h1-10,12,14,16H,11,13,15H2,(H,24,27) |
| InChIKey | HBTWCKRXTWUANJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |