C21H17N5O2S — CID 9033256
N'-(1-benzyl-3-thiophen-2-ylpyrazole-4-carbonyl)pyridine-2-carbohydrazide (PubChem CID 9033256) has the molecular formula C21H17N5O2S and a molecular weight of 403.47 g/mol. Its IUPAC name is N'-(1-benzyl-3-thiophen-2-ylpyrazole-4-carbonyl)pyridine-2-carbohydrazide.
| Compound Name | N'-(1-benzyl-3-thiophen-2-ylpyrazole-4-carbonyl)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 9033256 |
| Molecular Formula | C21H17N5O2S |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N'-(1-benzyl-3-thiophen-2-ylpyrazole-4-carbonyl)pyridine-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cn(Cc2ccccc2)nc1-c1cccs1)c1ccccn1 |
| InChI | InChI=1S/C21H17N5O2S/c27-20(23-24-21(28)17-9-4-5-11-22-17)16-14-26(13-15-7-2-1-3-8-15)25-19(16)18-10-6-12-29-18/h1-12,14H,13H2,(H,23,27)(H,24,28) |
| InChIKey | HIQAITXTMFGNNJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|