C19H21N3O2S — CID 42282130
1-benzyl-N-[(2S)-1-methoxypropan-2-yl]-3-thiophen-2-ylpyrazole-4-carboxamide (PubChem CID 42282130) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 1-benzyl-N-[(2S)-1-methoxypropan-2-yl]-3-thiophen-2-ylpyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[(2S)-1-methoxypropan-2-yl]-3-thiophen-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 42282130 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1-benzyl-N-[(2S)-1-methoxypropan-2-yl]-3-thiophen-2-ylpyrazole-4-carboxamide |
| SMILES | COC[C@H](C)NC(=O)c1cn(Cc2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C19H21N3O2S/c1-14(13-24-2)20-19(23)16-12-22(11-15-7-4-3-5-8-15)21-18(16)17-9-6-10-25-17/h3-10,12,14H,11,13H2,1-2H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | TUJORIGSIOJVOW-AWEZNQCLSA-N |
| XLogP | 3.42 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |