C21H18N4O3S — CID 9326455
1-benzyl-N'-(2-methylfuran-3-carbonyl)-3-thiophen-2-ylpyrazole-4-carbohydrazide (PubChem CID 9326455) has the molecular formula C21H18N4O3S and a molecular weight of 406.47 g/mol. Its IUPAC name is 1-benzyl-N'-(2-methylfuran-3-carbonyl)-3-thiophen-2-ylpyrazole-4-carbohydrazide.
| Compound Name | 1-benzyl-N'-(2-methylfuran-3-carbonyl)-3-thiophen-2-ylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9326455 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 1-benzyl-N'-(2-methylfuran-3-carbonyl)-3-thiophen-2-ylpyrazole-4-carbohydrazide |
| SMILES | Cc1occc1C(=O)NNC(=O)c1cn(Cc2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C21H18N4O3S/c1-14-16(9-10-28-14)20(26)22-23-21(27)17-13-25(12-15-6-3-2-4-7-15)24-19(17)18-8-5-11-29-18/h2-11,13H,12H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | OXQRCSMJWUWQRL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|