C23H24N4OS2 — CID 46592121
1-benzyl-N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-3-thiophen-2-ylpyrazole-4-carboxamide (PubChem CID 46592121) has the molecular formula C23H24N4OS2 and a molecular weight of 436.61 g/mol. Its IUPAC name is 1-benzyl-N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-3-thiophen-2-ylpyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-3-thiophen-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46592121 |
| Molecular Formula | C23H24N4OS2 |
| Molecular Weight | 436.61 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 1-benzyl-N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-3-thiophen-2-ylpyrazole-4-carboxamide |
| SMILES | CN(C)C(CNC(=O)c1cn(Cc2ccccc2)nc1-c1cccs1)c1ccsc1 |
| InChI | InChI=1S/C23H24N4OS2/c1-26(2)20(18-10-12-29-16-18)13-24-23(28)19-15-27(14-17-7-4-3-5-8-17)25-22(19)21-9-6-11-30-21/h3-12,15-16,20H,13-14H2,1-2H3,(H,24,28) |
| InChIKey | DQMGGDARFOMOTL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |