C26H26N4OS — CID 17449182
1-benzyl-N-(1-benzylpyrrolidin-3-yl)-3-thiophen-2-ylpyrazole-4-carboxamide (PubChem CID 17449182) has the molecular formula C26H26N4OS and a molecular weight of 442.59 g/mol. Its IUPAC name is 1-benzyl-N-(1-benzylpyrrolidin-3-yl)-3-thiophen-2-ylpyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-(1-benzylpyrrolidin-3-yl)-3-thiophen-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 17449182 |
| Molecular Formula | C26H26N4OS |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 1-benzyl-N-(1-benzylpyrrolidin-3-yl)-3-thiophen-2-ylpyrazole-4-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)C1)c1cn(Cc2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C26H26N4OS/c31-26(27-22-13-14-29(18-22)16-20-8-3-1-4-9-20)23-19-30(17-21-10-5-2-6-11-21)28-25(23)24-12-7-15-32-24/h1-12,15,19,22H,13-14,16-18H2,(H,27,31) |
| InChIKey | MMRVAUOPWCSLIK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |