C23H22N4O3S2 — CID 46454982
1-benzyl-N-[[4-(methylsulfamoyl)phenyl]methyl]-3-thiophen-2-ylpyrazole-4-carboxamide (PubChem CID 46454982) has the molecular formula C23H22N4O3S2 and a molecular weight of 466.59 g/mol. Its IUPAC name is 1-benzyl-N-[[4-(methylsulfamoyl)phenyl]methyl]-3-thiophen-2-ylpyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[[4-(methylsulfamoyl)phenyl]methyl]-3-thiophen-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46454982 |
| Molecular Formula | C23H22N4O3S2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 1-benzyl-N-[[4-(methylsulfamoyl)phenyl]methyl]-3-thiophen-2-ylpyrazole-4-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(CNC(=O)c2cn(Cc3ccccc3)nc2-c2cccs2)cc1 |
| InChI | InChI=1S/C23H22N4O3S2/c1-24-32(29,30)19-11-9-17(10-12-19)14-25-23(28)20-16-27(15-18-6-3-2-4-7-18)26-22(20)21-8-5-13-31-21/h2-13,16,24H,14-15H2,1H3,(H,25,28) |
| InChIKey | PDYAGFNKULUFGR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |