C27H22N4O3S — CID 60553559
(E)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 60553559) has the molecular formula C27H22N4O3S and a molecular weight of 482.57 g/mol. Its IUPAC name is (E)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 60553559 |
| Molecular Formula | C27H22N4O3S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | (E)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cn(-c2ccccc2)nc1-c1cccs1)Nc1ccc(N2C(=O)CCCC2=O)cc1 |
| InChI | InChI=1S/C27H22N4O3S/c32-24(28-20-12-14-22(15-13-20)31-25(33)9-4-10-26(31)34)16-11-19-18-30(21-6-2-1-3-7-21)29-27(19)23-8-5-17-35-23/h1-3,5-8,11-18H,4,9-10H2,(H,28,32)/b16-11+ |
| InChIKey | KRNRGOGCZKICFF-LFIBNONCSA-N |
| XLogP | 5.30 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|