C30H26N4O3S2 — CID 75535278
(E)-N-[4-methyl-3-[(3-methylphenyl)sulfamoyl]phenyl]-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 75535278) has the molecular formula C30H26N4O3S2 and a molecular weight of 554.70 g/mol. Its IUPAC name is (E)-N-[4-methyl-3-[(3-methylphenyl)sulfamoyl]phenyl]-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-methyl-3-[(3-methylphenyl)sulfamoyl]phenyl]-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 75535278 |
| Molecular Formula | C30H26N4O3S2 |
| Molecular Weight | 554.70 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | (E)-N-[4-methyl-3-[(3-methylphenyl)sulfamoyl]phenyl]-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2cc(NC(=O)/C=C/c3cn(-c4ccccc4)nc3-c3cccs3)ccc2C)c1 |
| InChI | InChI=1S/C30H26N4O3S2/c1-21-8-6-9-25(18-21)33-39(36,37)28-19-24(15-13-22(28)2)31-29(35)16-14-23-20-34(26-10-4-3-5-11-26)32-30(23)27-12-7-17-38-27/h3-20,33H,1-2H3,(H,31,35)/b16-14+ |
| InChIKey | BNKVSGQFKXNFTE-JQIJEIRASA-N |
| XLogP | 6.67 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.70 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|