C31H24ClN3O3S — CID 5198163
[2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] 3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate (PubChem CID 5198163) has the molecular formula C31H24ClN3O3S and a molecular weight of 554.07 g/mol. Its IUPAC name is [2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] 3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] 3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 5198163 |
| Molecular Formula | C31H24ClN3O3S |
| Molecular Weight | 554.07 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | [2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] 3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1ccc(NC(=O)C(OC(=O)C=Cc2cn(-c3ccccc3)nc2-c2cccs2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C31H24ClN3O3S/c1-21-14-16-24(19-26(21)32)33-31(37)30(22-9-4-2-5-10-22)38-28(36)17-15-23-20-35(25-11-6-3-7-12-25)34-29(23)27-13-8-18-39-27/h2-20,30H,1H3,(H,33,37) |
| InChIKey | LGRBUQWQYZDSDH-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.07 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|