C22H19NO3S — CID 8648465
[(1R)-2-(4-methylanilino)-2-oxo-1-phenylethyl] (E)-3-thiophen-2-ylprop-2-enoate (PubChem CID 8648465) has the molecular formula C22H19NO3S and a molecular weight of 377.47 g/mol. Its IUPAC name is [(1R)-2-(4-methylanilino)-2-oxo-1-phenylethyl] (E)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | [(1R)-2-(4-methylanilino)-2-oxo-1-phenylethyl] (E)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8648465 |
| Molecular Formula | C22H19NO3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | [(1R)-2-(4-methylanilino)-2-oxo-1-phenylethyl] (E)-3-thiophen-2-ylprop-2-enoate |
| SMILES | Cc1ccc(NC(=O)[C@H](OC(=O)/C=C/c2cccs2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19NO3S/c1-16-9-11-18(12-10-16)23-22(25)21(17-6-3-2-4-7-17)26-20(24)14-13-19-8-5-15-27-19/h2-15,21H,1H3,(H,23,25)/b14-13+/t21-/m1/s1 |
| InChIKey | RBZSZHIQTSTLRV-QZMUEMGWSA-N |
| XLogP | 4.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|