C20H20N2O4 — CID 7187582
[(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] (E)-3-(4-methylphenyl)prop-2-enoate (PubChem CID 7187582) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] (E)-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] (E)-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7187582 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] (E)-3-(4-methylphenyl)prop-2-enoate |
| SMILES | CNC(=O)NC(=O)[C@H](OC(=O)/C=C/c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O4/c1-14-8-10-15(11-9-14)12-13-17(23)26-18(16-6-4-3-5-7-16)19(24)22-20(25)21-2/h3-13,18H,1-2H3,(H2,21,22,24,25)/b13-12+/t18-/m1/s1 |
| InChIKey | MBOWJMZKWFWBSL-QFQMRYFISA-N |
| XLogP | 2.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|