C22H22N2O5 — CID 7486332
[(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate (PubChem CID 7486332) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate.
| Compound Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7486332 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate |
| SMILES | C=CCOc1ccc(/C=C/C(=O)O[C@@H](C(=O)NC(=O)NC)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N2O5/c1-3-15-28-18-12-9-16(10-13-18)11-14-19(25)29-20(17-7-5-4-6-8-17)21(26)24-22(27)23-2/h3-14,20H,1,15H2,2H3,(H2,23,24,26,27)/b14-11+/t20-/m1/s1 |
| InChIKey | DEGDWVXXHXXBAK-RDPWEWGOSA-N |
| XLogP | 3.00 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|