C21H23NO2 — CID 9301543
(E)-N-[(2R)-2-phenylpropyl]-3-(4-prop-2-enoxyphenyl)prop-2-enamide (PubChem CID 9301543) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (E)-N-[(2R)-2-phenylpropyl]-3-(4-prop-2-enoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(2R)-2-phenylpropyl]-3-(4-prop-2-enoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9301543 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (E)-N-[(2R)-2-phenylpropyl]-3-(4-prop-2-enoxyphenyl)prop-2-enamide |
| SMILES | C=CCOc1ccc(/C=C/C(=O)NC[C@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23NO2/c1-3-15-24-20-12-9-18(10-13-20)11-14-21(23)22-16-17(2)19-7-5-4-6-8-19/h3-14,17H,1,15-16H2,2H3,(H,22,23)/b14-11+/t17-/m0/s1 |
| InChIKey | BTSCQFFJXHAMOJ-WKOYGUFESA-N |
| XLogP | 4.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|