C24H29N2O3+ — CID 9149673
(E)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]-3-(4-prop-2-enoxyphenyl)prop-2-enamide (PubChem CID 9149673) has the molecular formula C24H29N2O3+ and a molecular weight of 393.51 g/mol. Its IUPAC name is (E)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]-3-(4-prop-2-enoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]-3-(4-prop-2-enoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9149673 |
| Molecular Formula | C24H29N2O3+ |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | (E)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]-3-(4-prop-2-enoxyphenyl)prop-2-enamide |
| SMILES | C=CCOc1ccc(/C=C/C(=O)N[C@@H](C[NH+]2CCOCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H28N2O3/c1-2-16-29-22-11-8-20(9-12-22)10-13-24(27)25-23(21-6-4-3-5-7-21)19-26-14-17-28-18-15-26/h2-13,23H,1,14-19H2,(H,25,27)/p+1/b13-10+/t23-/m0/s1 |
| InChIKey | HBURKHJGTMNLDT-YYVWFHOOSA-O |
| XLogP | 2.04 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|