C22H24ClN4O2+ — CID 9149533
(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]prop-2-enamide (PubChem CID 9149533) has the molecular formula C22H24ClN4O2+ and a molecular weight of 411.91 g/mol. Its IUPAC name is (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9149533 |
| Molecular Formula | C22H24ClN4O2+ |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1c(Cl)nc2ccccn12)N[C@@H](C[NH+]1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C22H23ClN4O2/c23-22-19(27-11-5-4-8-20(27)25-22)9-10-21(28)24-18(17-6-2-1-3-7-17)16-26-12-14-29-15-13-26/h1-11,18H,12-16H2,(H,24,28)/p+1/b10-9+/t18-/m0/s1 |
| InChIKey | AJTQUUPDBGHJGB-BBVFFXRHSA-O |
| XLogP | 1.77 |
| TPSA | 60.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|