C22H17ClN4O — CID 102603263
(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[phenyl(pyridin-2-yl)methyl]prop-2-enamide (PubChem CID 102603263) has the molecular formula C22H17ClN4O and a molecular weight of 388.86 g/mol. Its IUPAC name is (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[phenyl(pyridin-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[phenyl(pyridin-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 102603263 |
| Molecular Formula | C22H17ClN4O |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[phenyl(pyridin-2-yl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1c(Cl)nc2ccccn12)NC(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C22H17ClN4O/c23-22-18(27-15-7-5-11-19(27)25-22)12-13-20(28)26-21(16-8-2-1-3-9-16)17-10-4-6-14-24-17/h1-15,21H,(H,26,28)/b13-12+ |
| InChIKey | BNCISXSJPLNXJZ-OUKQBFOZSA-N |
| XLogP | 4.30 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|