C20H19ClFN3O3 — CID 86950286
(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]prop-2-enamide (PubChem CID 86950286) has the molecular formula C20H19ClFN3O3 and a molecular weight of 403.84 g/mol. Its IUPAC name is (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 86950286 |
| Molecular Formula | C20H19ClFN3O3 |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]prop-2-enamide |
| SMILES | COc1cc(F)c(C(C)NC(=O)/C=C/c2c(Cl)nc3ccccn23)cc1OC |
| InChI | InChI=1S/C20H19ClFN3O3/c1-12(13-10-16(27-2)17(28-3)11-14(13)22)23-19(26)8-7-15-20(21)24-18-6-4-5-9-25(15)18/h4-12H,1-3H3,(H,23,26)/b8-7+ |
| InChIKey | GUZOKJNDNDKQDY-BQYQJAHWSA-N |
| XLogP | 4.03 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|