C21H17ClN4O3S — CID 99140772
(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 99140772) has the molecular formula C21H17ClN4O3S and a molecular weight of 440.91 g/mol. Its IUPAC name is (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 99140772 |
| Molecular Formula | C21H17ClN4O3S |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | COc1ccc(-c2csc(NC(=O)/C=C/c3c(Cl)nc4ccccn34)n2)cc1OC |
| InChI | InChI=1S/C21H17ClN4O3S/c1-28-16-8-6-13(11-17(16)29-2)14-12-30-21(23-14)25-19(27)9-7-15-20(22)24-18-5-3-4-10-26(15)18/h3-12H,1-2H3,(H,23,25,27)/b9-7+ |
| InChIKey | BKNWEDBFDKVMPN-VQHVLOKHSA-N |
| XLogP | 4.78 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|