C20H20ClN3O4 — CID 76884661
3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[(2,4,6-trimethoxyphenyl)methyl]prop-2-enamide (PubChem CID 76884661) has the molecular formula C20H20ClN3O4 and a molecular weight of 401.85 g/mol. Its IUPAC name is 3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[(2,4,6-trimethoxyphenyl)methyl]prop-2-enamide.
| Compound Name | 3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[(2,4,6-trimethoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 76884661 |
| Molecular Formula | C20H20ClN3O4 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[(2,4,6-trimethoxyphenyl)methyl]prop-2-enamide |
| SMILES | COc1cc(OC)c(CNC(=O)C=Cc2c(Cl)nc3ccccn23)c(OC)c1 |
| InChI | InChI=1S/C20H20ClN3O4/c1-26-13-10-16(27-2)14(17(11-13)28-3)12-22-19(25)8-7-15-20(21)23-18-6-4-5-9-24(15)18/h4-11H,12H2,1-3H3,(H,22,25) |
| InChIKey | NOPWZXOALYPPME-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|