C16H11ClIN3O — CID 26264961
(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-(4-iodophenyl)prop-2-enamide (PubChem CID 26264961) has the molecular formula C16H11ClIN3O and a molecular weight of 423.64 g/mol. Its IUPAC name is (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-(4-iodophenyl)prop-2-enamide.
| Compound Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-(4-iodophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26264961 |
| Molecular Formula | C16H11ClIN3O |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 422.96 |
| IUPAC Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-(4-iodophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1c(Cl)nc2ccccn12)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C16H11ClIN3O/c17-16-13(21-10-2-1-3-14(21)20-16)8-9-15(22)19-12-6-4-11(18)5-7-12/h1-10H,(H,19,22)/b9-8+ |
| InChIKey | PESWHCQHAMYFSR-CMDGGOBGSA-N |
| XLogP | 4.24 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|